C11H10BrF2N3O5 — CID 153296468
ethyl 3-[[5-bromo-3-(difluoromethoxy)-2-pyridinyl]amino]-2-nitroprop-2-enoate (PubChem CID 153296468) has the molecular formula C11H10BrF2N3O5 and a molecular weight of 382.12 g/mol. Its IUPAC name is ethyl 3-[[5-bromo-3-(difluoromethoxy)-2-pyridinyl]amino]-2-nitroprop-2-enoate.
| Compound Name | ethyl 3-[[5-bromo-3-(difluoromethoxy)-2-pyridinyl]amino]-2-nitroprop-2-enoate |
|---|---|
| PubChem CID | 153296468 |
| Molecular Formula | C11H10BrF2N3O5 |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | ethyl 3-[[5-bromo-3-(difluoromethoxy)-2-pyridinyl]amino]-2-nitroprop-2-enoate |
| SMILES | CCOC(=O)C(=CNc1ncc(Br)cc1OC(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C11H10BrF2N3O5/c1-2-21-10(18)7(17(19)20)5-16-9-8(22-11(13)14)3-6(12)4-15-9/h3-5,11H,2H2,1H3,(H,15,16) |
| InChIKey | NUPUFOYYZOPBDR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|