C11H9F3N2O5 — CID 19990445
ethyl 2-[2-nitro-5-(trifluoromethyl)anilino]-2-oxoacetate (PubChem CID 19990445) has the molecular formula C11H9F3N2O5 and a molecular weight of 306.20 g/mol. Its IUPAC name is ethyl 2-[2-nitro-5-(trifluoromethyl)anilino]-2-oxoacetate.
| Compound Name | ethyl 2-[2-nitro-5-(trifluoromethyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 19990445 |
| Molecular Formula | C11H9F3N2O5 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | ethyl 2-[2-nitro-5-(trifluoromethyl)anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9F3N2O5/c1-2-21-10(18)9(17)15-7-5-6(11(12,13)14)3-4-8(7)16(19)20/h3-5H,2H2,1H3,(H,15,17) |
| InChIKey | PPDDPKJACSIYPF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|