C16H16F6N4O2 — CID 164983746
N-methyl-2-nitro-5-(trifluoromethyl)aniline;2-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 164983746) has the molecular formula C16H16F6N4O2 and a molecular weight of 410.32 g/mol. Its IUPAC name is N-methyl-2-nitro-5-(trifluoromethyl)aniline;2-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | N-methyl-2-nitro-5-(trifluoromethyl)aniline;2-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 164983746 |
| Molecular Formula | C16H16F6N4O2 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-methyl-2-nitro-5-(trifluoromethyl)aniline;2-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | CNc1cc(C(F)(F)F)ccc1N.CNc1cc(C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7F3N2O2.C8H9F3N2/c1-12-6-4-5(8(9,10)11)2-3-7(6)13(14)15;1-13-7-4-5(8(9,10)11)2-3-6(7)12/h2-4,12H,1H3;2-4,13H,12H2,1H3 |
| InChIKey | FVZSZQQOMVJZJN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|