C13H10F6O3 — CID 18370574
ethyl 3-[3,5-bis(trifluoromethyl)phenyl]-2-oxopropanoate (PubChem CID 18370574) has the molecular formula C13H10F6O3 and a molecular weight of 328.21 g/mol. Its IUPAC name is ethyl 3-[3,5-bis(trifluoromethyl)phenyl]-2-oxopropanoate.
| Compound Name | ethyl 3-[3,5-bis(trifluoromethyl)phenyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 18370574 |
| Molecular Formula | C13H10F6O3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | ethyl 3-[3,5-bis(trifluoromethyl)phenyl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F6O3/c1-2-22-11(21)10(20)5-7-3-8(12(14,15)16)6-9(4-7)13(17,18)19/h3-4,6H,2,5H2,1H3 |
| InChIKey | JZQDVVXUBWUBHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|