C11H9F6NO — CID 22370523
2-[3,5-bis(trifluoromethyl)phenyl]-N-methylacetamide (PubChem CID 22370523) has the molecular formula C11H9F6NO and a molecular weight of 285.19 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-methylacetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 22370523 |
| Molecular Formula | C11H9F6NO |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F6NO/c1-18-9(19)4-6-2-7(10(12,13)14)5-8(3-6)11(15,16)17/h2-3,5H,4H2,1H3,(H,18,19) |
| InChIKey | PKMAKQBFWJVOKQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |