C14H15F5O — CID 142885636
1-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]propan-2-one;ethene (PubChem CID 142885636) has the molecular formula C14H15F5O and a molecular weight of 294.26 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]propan-2-one;ethene.
| Compound Name | 1-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]propan-2-one;ethene |
|---|---|
| PubChem CID | 142885636 |
| Molecular Formula | C14H15F5O |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]propan-2-one;ethene |
| SMILES | C=C.CC(=O)Cc1cc(C(C)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F5O.C2H4/c1-7(18)3-8-4-9(11(2,13)14)6-10(5-8)12(15,16)17;1-2/h4-6H,3H2,1-2H3;1-2H2 |
| InChIKey | UGJFDYWKKUCHDG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|