C15H19F3N2O — CID 138723381
2-[3-(1,1-difluoroethyl)-5-(2-fluoropropan-2-yl)phenyl]-N-ethanimidoylacetamide (PubChem CID 138723381) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[3-(1,1-difluoroethyl)-5-(2-fluoropropan-2-yl)phenyl]-N-ethanimidoylacetamide.
| Compound Name | 2-[3-(1,1-difluoroethyl)-5-(2-fluoropropan-2-yl)phenyl]-N-ethanimidoylacetamide |
|---|---|
| PubChem CID | 138723381 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[3-(1,1-difluoroethyl)-5-(2-fluoropropan-2-yl)phenyl]-N-ethanimidoylacetamide |
| SMILES | [H]/N=C(\C)NC(=O)Cc1cc(C(C)(C)F)cc(C(C)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O/c1-9(19)20-13(21)7-10-5-11(14(2,3)16)8-12(6-10)15(4,17)18/h5-6,8H,7H2,1-4H3,(H2,19,20,21) |
| InChIKey | FQWJYBKOHJWYLZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|