C13H16F2N2O — CID 155303825
3-(1,1-difluoroethyl)-N-(3-iminobutan-2-yl)benzamide (PubChem CID 155303825) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-N-(3-iminobutan-2-yl)benzamide.
| Compound Name | 3-(1,1-difluoroethyl)-N-(3-iminobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 155303825 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(1,1-difluoroethyl)-N-(3-iminobutan-2-yl)benzamide |
| SMILES | [H]/N=C(\C)C(C)NC(=O)c1cccc(C(C)(F)F)c1 |
| InChI | InChI=1S/C13H16F2N2O/c1-8(16)9(2)17-12(18)10-5-4-6-11(7-10)13(3,14)15/h4-7,9,16H,1-3H3,(H,17,18)/b16-8+ |
| InChIKey | YMHYNRSOMSRPJV-LZYBPNLTSA-N |
| XLogP | 2.96 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|