C10H9Cl2F6NO — CID 87486222
2-[3,5-bis(trifluoromethyl)phenyl]acetamide;dihydrochloride (PubChem CID 87486222) has the molecular formula C10H9Cl2F6NO and a molecular weight of 344.08 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 87486222 |
| Molecular Formula | C10H9Cl2F6NO |
| Molecular Weight | 344.08 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6NO.2ClH/c11-9(12,13)6-1-5(3-8(17)18)2-7(4-6)10(14,15)16;;/h1-2,4H,3H2,(H2,17,18);2*1H |
| InChIKey | LOTQUOBQSZWNER-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |