C12H11F6NO2 — CID 89166264
3-[3,5-bis(trifluoromethyl)phenyl]-3-hydroxybutanamide (PubChem CID 89166264) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-3-hydroxybutanamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 89166264 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-hydroxybutanamide |
| SMILES | CC(O)(CC(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO2/c1-10(21,5-9(19)20)6-2-7(11(13,14)15)4-8(3-6)12(16,17)18/h2-4,21H,5H2,1H3,(H2,19,20) |
| InChIKey | CZZWOUYJARUGGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |