C12H11F6NO — CID 87395828
(3R)-3-[3,5-bis(trifluoromethyl)phenyl]butanamide (PubChem CID 87395828) has the molecular formula C12H11F6NO and a molecular weight of 299.21 g/mol. Its IUPAC name is (3R)-3-[3,5-bis(trifluoromethyl)phenyl]butanamide.
| Compound Name | (3R)-3-[3,5-bis(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 87395828 |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (3R)-3-[3,5-bis(trifluoromethyl)phenyl]butanamide |
| SMILES | C[C@H](CC(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO/c1-6(2-10(19)20)7-3-8(11(13,14)15)5-9(4-7)12(16,17)18/h3-6H,2H2,1H3,(H2,19,20)/t6-/m1/s1 |
| InChIKey | QFARLCLZXTXMGV-ZCFIWIBFSA-N |
| XLogP | 3.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |