C11H11F6NO — CID 54979927
2-amino-2-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 54979927) has the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 54979927 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CC(N)(CO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F6NO/c1-9(18,5-19)6-2-7(10(12,13)14)4-8(3-6)11(15,16)17/h2-4,19H,5,18H2,1H3 |
| InChIKey | JARKANKOWQRZON-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |