About N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine
N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine (PubChem CID 137418148) has the molecular formula C9H7F6NO
and a molecular weight of 259.15 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine |
| PubChem CID | 137418148 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine |
| SMILES | CN(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F6NO/c1-16(17)7-3-5(8(10,11)12)2-6(4-7)9(13,14)15/h2-4,17H,1H3 |
| InChIKey | FHNRGYNNYXGLDU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine (CID 137418148) is N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine is CN(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine?
The InChIKey is FHNRGYNNYXGLDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F6NO/c1-16(17)7-3-5(8(10,11)12)2-6(4-7)9(13,14)15/h2-4,17H,1H3.
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine?
N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine has a molecular weight of 259.15 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-N-methylhydroxylamine is sourced from PubChem (CID 137418148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).