C9H8F6N4O — CID 138738964
1,3-diamino-1-[3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 138738964) has the molecular formula C9H8F6N4O and a molecular weight of 302.18 g/mol. Its IUPAC name is 1,3-diamino-1-[3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1,3-diamino-1-[3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 138738964 |
| Molecular Formula | C9H8F6N4O |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1,3-diamino-1-[3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | NNC(=O)N(N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F6N4O/c10-8(11,12)4-1-5(9(13,14)15)3-6(2-4)19(17)7(20)18-16/h1-3H,16-17H2,(H,18,20) |
| InChIKey | KAWLOMACLVBOHK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|