C15H17F3N2O5 — CID 68816668
3-[N-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid (PubChem CID 68816668) has the molecular formula C15H17F3N2O5 and a molecular weight of 362.30 g/mol. Its IUPAC name is 3-[N-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid.
| Compound Name | 3-[N-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68816668 |
| Molecular Formula | C15H17F3N2O5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-[N-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)c1cc(N(N)C(=O)CC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O5/c1-14(2,3)25-13(24)8-4-9(15(16,17)18)6-10(5-8)20(19)11(21)7-12(22)23/h4-6H,7,19H2,1-3H3,(H,22,23) |
| InChIKey | YTGSKKVGEIKWFL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|