C15H17F3N2O5 — CID 21111788
3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid (PubChem CID 21111788) has the molecular formula C15H17F3N2O5 and a molecular weight of 362.30 g/mol. Its IUPAC name is 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid.
| Compound Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 21111788 |
| Molecular Formula | C15H17F3N2O5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)anilino]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)CC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O5/c1-14(2,3)25-13(24)20-10-5-8(15(16,17)18)4-9(6-10)19-11(21)7-12(22)23/h4-6H,7H2,1-3H3,(H,19,21)(H,20,24)(H,22,23) |
| InChIKey | LGKFKAZYKWEBNN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|