C16H18F4N2O3 — CID 142403499
tert-butyl N-[1-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]cyclopropyl]carbamate (PubChem CID 142403499) has the molecular formula C16H18F4N2O3 and a molecular weight of 362.32 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 142403499 |
| Molecular Formula | C16H18F4N2O3 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | tert-butyl N-[1-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)Nc2cc(F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H18F4N2O3/c1-14(2,3)25-13(24)22-15(4-5-15)12(23)21-11-7-9(16(18,19)20)6-10(17)8-11/h6-8H,4-5H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | BFODGLRZVYBSAF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |