C21H28F4N2O4 — CID 86883194
tert-butyl N-[1-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]carbamoyl]cyclopentyl]carbamate (PubChem CID 86883194) has the molecular formula C21H28F4N2O4 and a molecular weight of 448.46 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]carbamoyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]carbamoyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 86883194 |
| Molecular Formula | C21H28F4N2O4 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | tert-butyl N-[1-[[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]carbamoyl]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)Nc2cccc(COCC(F)(F)C(F)F)c2)CCCC1 |
| InChI | InChI=1S/C21H28F4N2O4/c1-19(2,3)31-18(29)27-20(9-4-5-10-20)17(28)26-15-8-6-7-14(11-15)12-30-13-21(24,25)16(22)23/h6-8,11,16H,4-5,9-10,12-13H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | OFFFPVHBPKPNTR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|