C21H24F4N2O2 — CID 55770303
1-[1-(2,5-dimethylphenyl)ethyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea (PubChem CID 55770303) has the molecular formula C21H24F4N2O2 and a molecular weight of 412.43 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylphenyl)ethyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea.
| Compound Name | 1-[1-(2,5-dimethylphenyl)ethyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 55770303 |
| Molecular Formula | C21H24F4N2O2 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[1-(2,5-dimethylphenyl)ethyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)Nc2cccc(COCC(F)(F)C(F)F)c2)c1 |
| InChI | InChI=1S/C21H24F4N2O2/c1-13-7-8-14(2)18(9-13)15(3)26-20(28)27-17-6-4-5-16(10-17)11-29-12-21(24,25)19(22)23/h4-10,15,19H,11-12H2,1-3H3,(H2,26,27,28) |
| InChIKey | LNQNOSPKCHQAGM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|