C18H16BrF4NO2 — CID 86890323
2-(2-bromophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]acetamide (PubChem CID 86890323) has the molecular formula C18H16BrF4NO2 and a molecular weight of 434.23 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]acetamide.
| Compound Name | 2-(2-bromophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86890323 |
| Molecular Formula | C18H16BrF4NO2 |
| Molecular Weight | 434.23 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 2-(2-bromophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1Br)Nc1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H16BrF4NO2/c19-15-7-2-1-5-13(15)9-16(25)24-14-6-3-4-12(8-14)10-26-11-18(22,23)17(20)21/h1-8,17H,9-11H2,(H,24,25) |
| InChIKey | QRSVWYFSSHOKKI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|