C22H25F4N3O2 — CID 86960333
1-(1-phenylpiperidin-3-yl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea (PubChem CID 86960333) has the molecular formula C22H25F4N3O2 and a molecular weight of 439.45 g/mol. Its IUPAC name is 1-(1-phenylpiperidin-3-yl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea.
| Compound Name | 1-(1-phenylpiperidin-3-yl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 86960333 |
| Molecular Formula | C22H25F4N3O2 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-(1-phenylpiperidin-3-yl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(COCC(F)(F)C(F)F)c1)NC1CCCN(c2ccccc2)C1 |
| InChI | InChI=1S/C22H25F4N3O2/c23-20(24)22(25,26)15-31-14-16-6-4-7-17(12-16)27-21(30)28-18-8-5-11-29(13-18)19-9-2-1-3-10-19/h1-4,6-7,9-10,12,18,20H,5,8,11,13-15H2,(H2,27,28,30) |
| InChIKey | NDIIQMBDYNJSGS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|