C16H20F4N2O2 — CID 86877132
3-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 86877132) has the molecular formula C16H20F4N2O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is 3-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86877132 |
| Molecular Formula | C16H20F4N2O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2cccc(COCC(F)(F)C(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F4N2O2/c1-11-5-6-22(8-11)15(23)21-13-4-2-3-12(7-13)9-24-10-16(19,20)14(17)18/h2-4,7,11,14H,5-6,8-10H2,1H3,(H,21,23) |
| InChIKey | INORSSQOCBWWAO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|