C19H20F4N2O3 — CID 86962608
2-(furan-2-yl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 86962608) has the molecular formula C19H20F4N2O3 and a molecular weight of 400.37 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(furan-2-yl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86962608 |
| Molecular Formula | C19H20F4N2O3 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(furan-2-yl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(COCC(F)(F)C(F)F)c1)N1CCCC1c1ccco1 |
| InChI | InChI=1S/C19H20F4N2O3/c20-17(21)19(22,23)12-27-11-13-4-1-5-14(10-13)24-18(26)25-8-2-6-15(25)16-7-3-9-28-16/h1,3-5,7,9-10,15,17H,2,6,8,11-12H2,(H,24,26) |
| InChIKey | JUVKSMSNQWASIB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|