C16H21ClF4N2O3 — CID 120925437
(2R,3S)-2-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 120925437) has the molecular formula C16H21ClF4N2O3 and a molecular weight of 400.80 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-2-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120925437 |
| Molecular Formula | C16H21ClF4N2O3 |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (2R,3S)-2-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1cccc(COCC(F)(F)C(F)F)c1.Cl |
| InChI | InChI=1S/C16H20F4N2O3.ClH/c1-10-13(21-5-6-25-10)14(23)22-12-4-2-3-11(7-12)8-24-9-16(19,20)15(17)18;/h2-4,7,10,13,15,21H,5-6,8-9H2,1H3,(H,22,23);1H/t10-,13+;/m1./s1 |
| InChIKey | RJPAAVIIWFSDJN-HTKOBJQYSA-N |
| XLogP | 2.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|