C21H26N2O4 — CID 120924219
(2R,3S)-2-methyl-N-[3-(2-phenoxyethoxymethyl)phenyl]morpholine-3-carboxamide (PubChem CID 120924219) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[3-(2-phenoxyethoxymethyl)phenyl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[3-(2-phenoxyethoxymethyl)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120924219 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (2R,3S)-2-methyl-N-[3-(2-phenoxyethoxymethyl)phenyl]morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1cccc(COCCOc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-16-20(22-10-11-26-16)21(24)23-18-7-5-6-17(14-18)15-25-12-13-27-19-8-3-2-4-9-19/h2-9,14,16,20,22H,10-13,15H2,1H3,(H,23,24)/t16-,20+/m1/s1 |
| InChIKey | ZEEWFCZZHFFAIW-UZLBHIALSA-N |
| XLogP | 2.60 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|