C21H26N2O3 — CID 119723072
N-[3-(2-phenoxyethoxymethyl)phenyl]-2-pyrrolidin-2-ylacetamide (PubChem CID 119723072) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[3-(2-phenoxyethoxymethyl)phenyl]-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-[3-(2-phenoxyethoxymethyl)phenyl]-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 119723072 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[3-(2-phenoxyethoxymethyl)phenyl]-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)Nc1cccc(COCCOc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2O3/c24-21(15-18-8-5-11-22-18)23-19-7-4-6-17(14-19)16-25-12-13-26-20-9-2-1-3-10-20/h1-4,6-7,9-10,14,18,22H,5,8,11-13,15-16H2,(H,23,24) |
| InChIKey | NFOULLDGKIMJCD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|