C17H22F4N2O3 — CID 51118830
4-(hydroxymethyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]piperidine-1-carboxamide (PubChem CID 51118830) has the molecular formula C17H22F4N2O3 and a molecular weight of 378.37 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(hydroxymethyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 51118830 |
| Molecular Formula | C17H22F4N2O3 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-(hydroxymethyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(COCC(F)(F)C(F)F)c1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C17H22F4N2O3/c18-15(19)17(20,21)11-26-10-13-2-1-3-14(8-13)22-16(25)23-6-4-12(9-24)5-7-23/h1-3,8,12,15,24H,4-7,9-11H2,(H,22,25) |
| InChIKey | YIKVTDIAUMEANJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|