C19H15F5N4O2 — CID 86881382
1-(4-fluorophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]triazole-4-carboxamide (PubChem CID 86881382) has the molecular formula C19H15F5N4O2 and a molecular weight of 426.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 86881382 |
| Molecular Formula | C19H15F5N4O2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(COCC(F)(F)C(F)F)c1)c1cn(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C19H15F5N4O2/c20-13-4-6-15(7-5-13)28-9-16(26-27-28)17(29)25-14-3-1-2-12(8-14)10-30-11-19(23,24)18(21)22/h1-9,18H,10-11H2,(H,25,29) |
| InChIKey | CBDXKDRXWZQMSJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|