C20H15N5O3 — CID 46576505
N-[3-(furan-2-carbonylamino)phenyl]-1-phenyltriazole-4-carboxamide (PubChem CID 46576505) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[3-(furan-2-carbonylamino)phenyl]-1-phenyltriazole-4-carboxamide.
| Compound Name | N-[3-(furan-2-carbonylamino)phenyl]-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46576505 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[3-(furan-2-carbonylamino)phenyl]-1-phenyltriazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccco2)c1)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C20H15N5O3/c26-19(17-13-25(24-23-17)16-8-2-1-3-9-16)21-14-6-4-7-15(12-14)22-20(27)18-10-5-11-28-18/h1-13H,(H,21,26)(H,22,27) |
| InChIKey | LXRFAMMKYMLRFV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |