C15H9Cl3N4O — CID 99586321
1-phenyl-N-(2,4,5-trichlorophenyl)triazole-4-carboxamide (PubChem CID 99586321) has the molecular formula C15H9Cl3N4O and a molecular weight of 367.62 g/mol. Its IUPAC name is 1-phenyl-N-(2,4,5-trichlorophenyl)triazole-4-carboxamide.
| Compound Name | 1-phenyl-N-(2,4,5-trichlorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 99586321 |
| Molecular Formula | C15H9Cl3N4O |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 1-phenyl-N-(2,4,5-trichlorophenyl)triazole-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C15H9Cl3N4O/c16-10-6-12(18)13(7-11(10)17)19-15(23)14-8-22(21-20-14)9-4-2-1-3-5-9/h1-8H,(H,19,23) |
| InChIKey | YAQQUCXWHYVYML-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|