C21H23N5O3S — CID 46686156
N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1-phenyltriazole-4-carboxamide (PubChem CID 46686156) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1-phenyltriazole-4-carboxamide.
| Compound Name | N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46686156 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1-phenyltriazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C21H23N5O3S/c1-16-10-11-18(30(28,29)25-12-6-3-7-13-25)14-19(16)22-21(27)20-15-26(24-23-20)17-8-4-2-5-9-17/h2,4-5,8-11,14-15H,3,6-7,12-13H2,1H3,(H,22,27) |
| InChIKey | AARZEJJIRYJYJG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |