C20H21N5O3S — CID 60549527
1-phenyl-N-(2-piperidin-1-ylsulfonylphenyl)triazole-4-carboxamide (PubChem CID 60549527) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 1-phenyl-N-(2-piperidin-1-ylsulfonylphenyl)triazole-4-carboxamide.
| Compound Name | 1-phenyl-N-(2-piperidin-1-ylsulfonylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 60549527 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1-phenyl-N-(2-piperidin-1-ylsulfonylphenyl)triazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)N1CCCCC1)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C20H21N5O3S/c26-20(18-15-25(23-22-18)16-9-3-1-4-10-16)21-17-11-5-6-12-19(17)29(27,28)24-13-7-2-8-14-24/h1,3-6,9-12,15H,2,7-8,13-14H2,(H,21,26) |
| InChIKey | KGUTYBXUEFNYOD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |