C22H23N3O5S — CID 60549570
5-[(2-oxo-1-pyridinyl)methyl]-N-(2-piperidin-1-ylsulfonylphenyl)furan-2-carboxamide (PubChem CID 60549570) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 5-[(2-oxo-1-pyridinyl)methyl]-N-(2-piperidin-1-ylsulfonylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-(2-piperidin-1-ylsulfonylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60549570 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-(2-piperidin-1-ylsulfonylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)N1CCCCC1)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C22H23N3O5S/c26-21-10-4-7-13-24(21)16-17-11-12-19(30-17)22(27)23-18-8-2-3-9-20(18)31(28,29)25-14-5-1-6-15-25/h2-4,7-13H,1,5-6,14-16H2,(H,23,27) |
| InChIKey | RDZVUSFAUZKKBS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |