C22H23N3O4 — CID 31518398
N-[2-[[(2S)-butan-2-yl]carbamoyl]phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 31518398) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[2-[[(2S)-butan-2-yl]carbamoyl]phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(2S)-butan-2-yl]carbamoyl]phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31518398 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-[[(2S)-butan-2-yl]carbamoyl]phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1ccccc1NC(=O)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-15(2)23-21(27)17-8-4-5-9-18(17)24-22(28)19-12-11-16(29-19)14-25-13-7-6-10-20(25)26/h4-13,15H,3,14H2,1-2H3,(H,23,27)(H,24,28)/t15-/m0/s1 |
| InChIKey | NHVRINVQMHZSGP-HNNXBMFYSA-N |
| XLogP | 3.27 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |