C19H18N2O5S — CID 39863132
N-(4-ethylsulfonylphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 39863132) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-(4-ethylsulfonylphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-(4-ethylsulfonylphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39863132 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-(4-ethylsulfonylphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2ccc(Cn3ccccc3=O)o2)cc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-2-27(24,25)16-9-6-14(7-10-16)20-19(23)17-11-8-15(26-17)13-21-12-4-3-5-18(21)22/h3-12H,2,13H2,1H3,(H,20,23) |
| InChIKey | GOTCHMOJLBUJQU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |