C18H14F2N2O4 — CID 31328902
N-[4-(difluoromethoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 31328902) has the molecular formula C18H14F2N2O4 and a molecular weight of 360.32 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31328902 |
| Molecular Formula | C18H14F2N2O4 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C18H14F2N2O4/c19-18(20)26-13-6-4-12(5-7-13)21-17(24)15-9-8-14(25-15)11-22-10-2-1-3-16(22)23/h1-10,18H,11H2,(H,21,24) |
| InChIKey | SUBLUXVWXRKFJA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |