C22H23N3O6 — CID 32805465
N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide (PubChem CID 32805465) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide.
| Compound Name | N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 32805465 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N'-[(2R)-2-(4-ethoxyphenoxy)propanoyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide |
| SMILES | CCOc1ccc(O[C@H](C)C(=O)NNC(=O)c2ccc(Cn3ccccc3=O)o2)cc1 |
| InChI | InChI=1S/C22H23N3O6/c1-3-29-16-7-9-17(10-8-16)30-15(2)21(27)23-24-22(28)19-12-11-18(31-19)14-25-13-5-4-6-20(25)26/h4-13,15H,3,14H2,1-2H3,(H,23,27)(H,24,28)/t15-/m1/s1 |
| InChIKey | OIMOXGMFPGMFCU-OAHLLOKOSA-N |
| XLogP | 2.12 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|