C20H15N3O3 — CID 86917103
5-[(2-oxo-1-pyridinyl)methyl]-N-quinolin-5-ylfuran-2-carboxamide (PubChem CID 86917103) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-[(2-oxo-1-pyridinyl)methyl]-N-quinolin-5-ylfuran-2-carboxamide.
| Compound Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-quinolin-5-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86917103 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-quinolin-5-ylfuran-2-carboxamide |
| SMILES | O=C(Nc1cccc2ncccc12)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C20H15N3O3/c24-19-8-1-2-12-23(19)13-14-9-10-18(26-14)20(25)22-17-7-3-6-16-15(17)5-4-11-21-16/h1-12H,13H2,(H,22,25) |
| InChIKey | JGBCDYNWZLIGFD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |