C17H12FN3O5 — CID 134024539
N-(2-fluoro-5-nitrophenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 134024539) has the molecular formula C17H12FN3O5 and a molecular weight of 357.30 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134024539 |
| Molecular Formula | C17H12FN3O5 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C17H12FN3O5/c18-13-6-4-11(21(24)25)9-14(13)19-17(23)15-7-5-12(26-15)10-20-8-2-1-3-16(20)22/h1-9H,10H2,(H,19,23) |
| InChIKey | CJSBQKBXRPAAHF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|