C24H19ClN2O5 — CID 134024440
N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 134024440) has the molecular formula C24H19ClN2O5 and a molecular weight of 450.88 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134024440 |
| Molecular Formula | C24H19ClN2O5 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(Oc2ccc(Cl)cc2NC(=O)c2ccc(Cn3ccccc3=O)o2)cc1 |
| InChI | InChI=1S/C24H19ClN2O5/c1-30-17-6-8-18(9-7-17)31-21-11-5-16(25)14-20(21)26-24(29)22-12-10-19(32-22)15-27-13-3-2-4-23(27)28/h2-14H,15H2,1H3,(H,26,29) |
| InChIKey | JXUSJNDQIPUBTR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |