C23H17ClN2O4 — CID 31336184
N-(5-chloro-2-phenoxyphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 31336184) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31336184 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Oc1ccccc1)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C23H17ClN2O4/c24-16-9-11-20(29-17-6-2-1-3-7-17)19(14-16)25-23(28)21-12-10-18(30-21)15-26-13-5-4-8-22(26)27/h1-14H,15H2,(H,25,28) |
| InChIKey | JAMMLIDNVKCTDO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |