C15H12N4O5 — CID 19463215
N-(2-hydroxy-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 19463215) has the molecular formula C15H12N4O5 and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(2-hydroxy-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-(2-hydroxy-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463215 |
| Molecular Formula | C15H12N4O5 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-(2-hydroxy-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C15H12N4O5/c20-13-8-10(19(22)23)2-4-12(13)17-15(21)14-5-3-11(24-14)9-18-7-1-6-16-18/h1-8,20H,9H2,(H,17,21) |
| InChIKey | ZNWROHNPAKYSPL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|