C16H11N5O4 — CID 19463192
N-(2-cyano-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 19463192) has the molecular formula C16H11N5O4 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463192 |
| Molecular Formula | C16H11N5O4 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C16H11N5O4/c17-9-11-8-12(21(23)24)2-4-14(11)19-16(22)15-5-3-13(25-15)10-20-7-1-6-18-20/h1-8H,10H2,(H,19,22) |
| InChIKey | XLKTUTHYMMDNGN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|