C17H19Cl2N3O3S — CID 55919824
4,5-dichloro-1-methyl-N-(2-piperidin-1-ylsulfonylphenyl)pyrrole-2-carboxamide (PubChem CID 55919824) has the molecular formula C17H19Cl2N3O3S and a molecular weight of 416.33 g/mol. Its IUPAC name is 4,5-dichloro-1-methyl-N-(2-piperidin-1-ylsulfonylphenyl)pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-1-methyl-N-(2-piperidin-1-ylsulfonylphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55919824 |
| Molecular Formula | C17H19Cl2N3O3S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 4,5-dichloro-1-methyl-N-(2-piperidin-1-ylsulfonylphenyl)pyrrole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccccc2S(=O)(=O)N2CCCCC2)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H19Cl2N3O3S/c1-21-14(11-12(18)16(21)19)17(23)20-13-7-3-4-8-15(13)26(24,25)22-9-5-2-6-10-22/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,20,23) |
| InChIKey | UKJBGOJSQMSOEU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |