C17H22N2O3S — CID 60549459
(2E,4E)-N-(2-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide (PubChem CID 60549459) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is (2E,4E)-N-(2-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 60549459 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2E,4E)-N-(2-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H22N2O3S/c1-2-3-5-12-17(20)18-15-10-6-7-11-16(15)23(21,22)19-13-8-4-9-14-19/h2-3,5-7,10-12H,4,8-9,13-14H2,1H3,(H,18,20)/b3-2+,12-5+ |
| InChIKey | NWUFNQHMFJNHCT-AYFNZWQASA-N |
| XLogP | 2.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|