C17H14N8O — CID 24627598
1-benzyl-N-[3-(tetrazol-1-yl)phenyl]triazole-4-carboxamide (PubChem CID 24627598) has the molecular formula C17H14N8O and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-benzyl-N-[3-(tetrazol-1-yl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-(tetrazol-1-yl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 24627598 |
| Molecular Formula | C17H14N8O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-benzyl-N-[3-(tetrazol-1-yl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cnnn2)c1)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H14N8O/c26-17(16-11-24(22-20-16)10-13-5-2-1-3-6-13)19-14-7-4-8-15(9-14)25-12-18-21-23-25/h1-9,11-12H,10H2,(H,19,26) |
| InChIKey | YSBKKPLWRXALGR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |