C17H14N4O3 — CID 31699405
N-(1,3-benzodioxol-5-yl)-1-benzyltriazole-4-carboxamide (PubChem CID 31699405) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-benzyltriazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-benzyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 31699405 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-benzyltriazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H14N4O3/c22-17(18-13-6-7-15-16(8-13)24-11-23-15)14-10-21(20-19-14)9-12-4-2-1-3-5-12/h1-8,10H,9,11H2,(H,18,22) |
| InChIKey | CPIDORIZRMQTJM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |