C18H14ClN3O3 — CID 35322937
N-(1,3-benzodioxol-5-yl)-4-[(4-chloropyrazol-1-yl)methyl]benzamide (PubChem CID 35322937) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-[(4-chloropyrazol-1-yl)methyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-[(4-chloropyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 35322937 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-[(4-chloropyrazol-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(Cn2cc(Cl)cn2)cc1 |
| InChI | InChI=1S/C18H14ClN3O3/c19-14-8-20-22(10-14)9-12-1-3-13(4-2-12)18(23)21-15-5-6-16-17(7-15)25-11-24-16/h1-8,10H,9,11H2,(H,21,23) |
| InChIKey | BBWBIKDJZFLBRX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |