C19H20N4O4 — CID 18152035
1-benzyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide (PubChem CID 18152035) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-benzyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 18152035 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-benzyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1cc(NC(=O)c2cn(Cc3ccccc3)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O4/c1-25-16-9-14(10-17(26-2)18(16)27-3)20-19(24)15-12-23(22-21-15)11-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3,(H,20,24) |
| InChIKey | CSUDBQLCNNBURF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |