C18H15N5O2S — CID 31031821
1-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)triazole-4-carboxamide (PubChem CID 31031821) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 1-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 31031821 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)triazole-4-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)c3cn(Cc4ccccc4)nn3)sc2c1 |
| InChI | InChI=1S/C18H15N5O2S/c1-25-13-7-8-14-16(9-13)26-18(19-14)20-17(24)15-11-23(22-21-15)10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,19,20,24) |
| InChIKey | DVXGMAVRYWYONC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |